C35H52O3Si — CID 153277148
[5-[dimethyl-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate (PubChem CID 153277148) has the molecular formula C35H52O3Si and a molecular weight of 548.88 g/mol. Its IUPAC name is [5-[dimethyl-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[dimethyl-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277148 |
| Molecular Formula | C35H52O3Si |
| Molecular Weight | 548.88 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | [5-[dimethyl-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CCC[Si](C)(C)c1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C35H52O3Si/c1-6-7-8-10-28-12-14-30(15-13-28)31-16-18-32(19-17-31)33-20-22-34(23-21-33)39(4,5)24-9-11-29(25-36)26-38-35(37)27(2)3/h16-23,28-30,36H,2,6-15,24-26H2,1,3-5H3 |
| InChIKey | FLBMRNGKSOMPFX-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.88 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|