C29H42O3Si — CID 153277106
[5-[dimethyl-[4-(4-pentylphenyl)phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate (PubChem CID 153277106) has the molecular formula C29H42O3Si and a molecular weight of 466.74 g/mol. Its IUPAC name is [5-[dimethyl-[4-(4-pentylphenyl)phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[dimethyl-[4-(4-pentylphenyl)phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277106 |
| Molecular Formula | C29H42O3Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [5-[dimethyl-[4-(4-pentylphenyl)phenyl]silyl]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CCC[Si](C)(C)c1ccc(-c2ccc(CCCCC)cc2)cc1 |
| InChI | InChI=1S/C29H42O3Si/c1-6-7-8-10-24-12-14-26(15-13-24)27-16-18-28(19-17-27)33(4,5)20-9-11-25(21-30)22-32-29(31)23(2)3/h12-19,25,30H,2,6-11,20-22H2,1,3-5H3 |
| InChIKey | YSHJHGACYIAXTN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|