C27H38O3Si — CID 153277071
[2-[3-hydroxypropyl(dimethyl)silyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 153277071) has the molecular formula C27H38O3Si and a molecular weight of 438.68 g/mol. Its IUPAC name is [2-[3-hydroxypropyl(dimethyl)silyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-[3-hydroxypropyl(dimethyl)silyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277071 |
| Molecular Formula | C27H38O3Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [2-[3-hydroxypropyl(dimethyl)silyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(CCCCC)cc2)ccc1[Si](C)(C)CCCO |
| InChI | InChI=1S/C27H38O3Si/c1-6-7-8-10-22-11-13-23(14-12-22)24-15-16-26(31(4,5)18-9-17-28)25(19-24)20-30-27(29)21(2)3/h11-16,19,28H,2,6-10,17-18,20H2,1,3-5H3 |
| InChIKey | VKLKLHFJKJWGMO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|