C35H44F2O3Si — CID 153276887
[5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-2-[5-hydroxypentyl(dimethyl)silyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 153276887) has the molecular formula C35H44F2O3Si and a molecular weight of 578.82 g/mol. Its IUPAC name is [5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-2-[5-hydroxypentyl(dimethyl)silyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-2-[5-hydroxypentyl(dimethyl)silyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153276887 |
| Molecular Formula | C35H44F2O3Si |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | [5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-2-[5-hydroxypentyl(dimethyl)silyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc(CCCCC)cc3)c(F)c2F)ccc1[Si](C)(C)CCCCCO |
| InChI | InChI=1S/C35H44F2O3Si/c1-6-7-9-12-26-13-15-27(16-14-26)30-18-19-31(34(37)33(30)36)28-17-20-32(41(4,5)22-11-8-10-21-38)29(23-28)24-40-35(39)25(2)3/h13-20,23,38H,2,6-12,21-22,24H2,1,3-5H3 |
| InChIKey | PMGSQOGCTDKRJX-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|