C42H62F2O4Si — CID 147607622
[5-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 147607622) has the molecular formula C42H62F2O4Si and a molecular weight of 697.04 g/mol. Its IUPAC name is [5-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 147607622 |
| Molecular Formula | C42H62F2O4Si |
| Molecular Weight | 697.04 g/mol |
| Exact Mass | 696.44 |
| IUPAC Name | [5-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)c(F)c2F)ccc1[Si](C)(C)CCCC(CO)CO |
| InChI | InChI=1S/C42H62F2O4Si/c1-6-7-8-10-30-12-14-32(15-13-30)33-16-18-34(19-17-33)37-21-22-38(41(44)40(37)43)35-20-23-39(36(25-35)28-48-42(47)29(2)3)49(4,5)24-9-11-31(26-45)27-46/h20-23,25,30-34,45-46H,2,6-19,24,26-28H2,1,3-5H3 |
| InChIKey | GBJHRDUPMCBXSM-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.04 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|