C47H64O6Si — CID 153276925
[2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]-3-(2-methylprop-2-enoyloxymethyl)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 153276925) has the molecular formula C47H64O6Si and a molecular weight of 753.11 g/mol. Its IUPAC name is [2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]-3-(2-methylprop-2-enoyloxymethyl)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]-3-(2-methylprop-2-enoyloxymethyl)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153276925 |
| Molecular Formula | C47H64O6Si |
| Molecular Weight | 753.11 g/mol |
| Exact Mass | 752.45 |
| IUPAC Name | [2-[[5-hydroxy-4-(hydroxymethyl)pentyl]-dimethylsilyl]-3-(2-methylprop-2-enoyloxymethyl)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2)cc(COC(=O)C(=C)C)c1[Si](C)(C)CCCC(CO)CO |
| InChI | InChI=1S/C47H64O6Si/c1-8-9-10-12-35-14-16-37(17-15-35)38-18-20-39(21-19-38)40-22-24-41(25-23-40)42-27-43(31-52-46(50)33(2)3)45(44(28-42)32-53-47(51)34(4)5)54(6,7)26-11-13-36(29-48)30-49/h18-25,27-28,35-37,48-49H,2,4,8-17,26,29-32H2,1,3,5-7H3 |
| InChIKey | DYDGYHCGIRHUSN-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.11 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|