C32H44F2O3Si — CID 153276964
3-[[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 153276964) has the molecular formula C32H44F2O3Si and a molecular weight of 542.78 g/mol. Its IUPAC name is 3-[[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 3-[[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 153276964 |
| Molecular Formula | C32H44F2O3Si |
| Molecular Weight | 542.78 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 3-[[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCC[Si](C)(C)c1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C32H44F2O3Si/c1-5-6-7-9-24-10-12-25(13-11-24)26-14-16-27(17-15-26)28-18-19-29(31(34)30(28)33)38(3,4)21-8-20-37-32(36)23(2)22-35/h14-19,24-25,35H,2,5-13,20-22H2,1,3-4H3 |
| InChIKey | XNGYHEMSBJLWAU-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.78 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|