C43H72O7Si2 — CID 154609875
3-[[2-ethoxy-3-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl-dimethylsilyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 154609875) has the molecular formula C43H72O7Si2 and a molecular weight of 757.21 g/mol. Its IUPAC name is 3-[[2-ethoxy-3-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl-dimethylsilyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 3-[[2-ethoxy-3-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl-dimethylsilyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 154609875 |
| Molecular Formula | C43H72O7Si2 |
| Molecular Weight | 757.21 g/mol |
| Exact Mass | 756.48 |
| IUPAC Name | 3-[[2-ethoxy-3-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl-dimethylsilyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-dimethylsilyl]propyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCC[Si](C)(C)c1cc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc([Si](C)(C)CCCOC(=O)C(=C)CO)c1OCC |
| InChI | InChI=1S/C43H72O7Si2/c1-9-11-12-15-34-16-18-35(19-17-34)36-20-22-37(23-21-36)38-28-39(51(5,6)26-13-24-49-42(46)32(3)30-44)41(48-10-2)40(29-38)52(7,8)27-14-25-50-43(47)33(4)31-45/h28-29,34-37,44-45H,3-4,9-27,30-31H2,1-2,5-8H3 |
| InChIKey | KCZKSAWAYWYECG-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.21 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|