C41H68O5Si — CID 148578510
5-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]pentyl 2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]prop-2-enoate (PubChem CID 148578510) has the molecular formula C41H68O5Si and a molecular weight of 669.08 g/mol. Its IUPAC name is 5-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]pentyl 2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]prop-2-enoate.
| Compound Name | 5-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]pentyl 2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 148578510 |
| Molecular Formula | C41H68O5Si |
| Molecular Weight | 669.08 g/mol |
| Exact Mass | 668.48 |
| IUPAC Name | 5-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]pentyl 2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]prop-2-enoate |
| SMILES | C=C(COCC1COC(C)(C)OC1)C(=O)OCCCCC[Si](C)(C)c1ccc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C41H68O5Si/c1-7-8-10-13-33-14-16-35(17-15-33)36-18-20-37(21-19-36)38-22-24-39(25-23-38)47(5,6)27-12-9-11-26-44-40(42)32(2)28-43-29-34-30-45-41(3,4)46-31-34/h22-25,33-37H,2,7-21,26-31H2,1,3-6H3 |
| InChIKey | MYGRADGLFVQMRH-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.08 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|