C28H40F2O2 — CID 59360200
6-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]hexyl 2-methylprop-2-enoate (PubChem CID 59360200) has the molecular formula C28H40F2O2 and a molecular weight of 446.62 g/mol. Its IUPAC name is 6-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59360200 |
| Molecular Formula | C28H40F2O2 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 6-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H40F2O2/c1-20(2)28(31)32-18-6-4-3-5-7-21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-16-17-26(29)27(30)19-25/h16-17,19,21-24H,1,3-15,18H2,2H3 |
| InChIKey | KSOFJVUHFZSUMT-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|