C32H48F2O3 — CID 59937239
6-[2,6-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]hexyl prop-2-enoate (PubChem CID 59937239) has the molecular formula C32H48F2O3 and a molecular weight of 518.73 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[2,6-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 59937239 |
| Molecular Formula | C32H48F2O3 |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | 6-[2,6-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1c(F)cc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1F |
| InChI | InChI=1S/C32H48F2O3/c1-3-5-8-11-24-12-14-25(15-13-24)26-16-18-27(19-17-26)28-22-29(33)32(30(34)23-28)37-21-10-7-6-9-20-36-31(35)4-2/h4,22-27H,2-3,5-21H2,1H3 |
| InChIKey | COPULQCHJJKNRC-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|