C24H32F2O2 — CID 59360278
3-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]propyl prop-2-enoate (PubChem CID 59360278) has the molecular formula C24H32F2O2 and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]propyl prop-2-enoate.
| Compound Name | 3-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 59360278 |
| Molecular Formula | C24H32F2O2 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H32F2O2/c1-2-24(27)28-15-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-14-22(25)23(26)16-21/h2,13-14,16-20H,1,3-12,15H2 |
| InChIKey | UKFHTUYIYGVYRV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|