C18H30O2 — CID 70268228
3-(4-cyclohexylcyclohexyl)propyl prop-2-enoate (PubChem CID 70268228) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 3-(4-cyclohexylcyclohexyl)propyl prop-2-enoate.
| Compound Name | 3-(4-cyclohexylcyclohexyl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 70268228 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 3-(4-cyclohexylcyclohexyl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H30O2/c1-2-18(19)20-14-6-7-15-10-12-17(13-11-15)16-8-4-3-5-9-16/h2,15-17H,1,3-14H2 |
| InChIKey | QDZZAXACWFZIMZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|