C46H72O10 — CID 70118742
[3-[4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexanecarbonyl]oxy-1,4-dioxan-2-yl] 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate (PubChem CID 70118742) has the molecular formula C46H72O10 and a molecular weight of 785.07 g/mol. Its IUPAC name is [3-[4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexanecarbonyl]oxy-1,4-dioxan-2-yl] 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate.
| Compound Name | [3-[4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexanecarbonyl]oxy-1,4-dioxan-2-yl] 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70118742 |
| Molecular Formula | C46H72O10 |
| Molecular Weight | 785.07 g/mol |
| Exact Mass | 784.51 |
| IUPAC Name | [3-[4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexanecarbonyl]oxy-1,4-dioxan-2-yl] 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCC1CCC(CCC2CCC(C(=O)OC3OCCOC3OC(=O)C3CCC(CCC4CCC(CCCOC(=O)C=C)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C46H72O10/c1-3-41(47)51-29-5-7-33-9-13-35(14-10-33)17-19-37-21-25-39(26-22-37)43(49)55-45-46(54-32-31-53-45)56-44(50)40-27-23-38(24-28-40)20-18-36-15-11-34(12-16-36)8-6-30-52-42(48)4-2/h3-4,33-40,45-46H,1-2,5-32H2 |
| InChIKey | YGWQHZNXLBQEQL-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.07 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|