C12H20O4 — CID 141157724
3-(3,4-dihydroxycyclohexyl)propyl prop-2-enoate (PubChem CID 141157724) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(3,4-dihydroxycyclohexyl)propyl prop-2-enoate.
| Compound Name | 3-(3,4-dihydroxycyclohexyl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 141157724 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-(3,4-dihydroxycyclohexyl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1CCC(O)C(O)C1 |
| InChI | InChI=1S/C12H20O4/c1-2-12(15)16-7-3-4-9-5-6-10(13)11(14)8-9/h2,9-11,13-14H,1,3-8H2 |
| InChIKey | XCBBGDFCVSZOEX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|