C21H38O6 — CID 59015366
8-(3,4-dihydroxycyclohexyl)octyl 3,4-dihydroxycyclohexane-1-carboxylate (PubChem CID 59015366) has the molecular formula C21H38O6 and a molecular weight of 386.53 g/mol. Its IUPAC name is 8-(3,4-dihydroxycyclohexyl)octyl 3,4-dihydroxycyclohexane-1-carboxylate.
| Compound Name | 8-(3,4-dihydroxycyclohexyl)octyl 3,4-dihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59015366 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 8-(3,4-dihydroxycyclohexyl)octyl 3,4-dihydroxycyclohexane-1-carboxylate |
| SMILES | O=C(OCCCCCCCCC1CCC(O)C(O)C1)C1CCC(O)C(O)C1 |
| InChI | InChI=1S/C21H38O6/c22-17-10-8-15(13-19(17)24)7-5-3-1-2-4-6-12-27-21(26)16-9-11-18(23)20(25)14-16/h15-20,22-25H,1-14H2 |
| InChIKey | MDNVDNMQFWEFGJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|