C27H44O4 — CID 21461607
cyclohexyl 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate (PubChem CID 21461607) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is cyclohexyl 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate.
| Compound Name | cyclohexyl 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 21461607 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | cyclohexyl 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCC1CCC(CCC2CCC(C(=O)OC3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C27H44O4/c1-2-26(28)30-20-6-7-21-10-12-22(13-11-21)14-15-23-16-18-24(19-17-23)27(29)31-25-8-4-3-5-9-25/h2,21-25H,1,3-20H2 |
| InChIKey | LEGSRIGCCRNURM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|