C27H42O8 — CID 146262477
4-O-(4-propan-2-yloxycarbonylcyclohexyl) 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate (PubChem CID 146262477) has the molecular formula C27H42O8 and a molecular weight of 494.63 g/mol. Its IUPAC name is 4-O-(4-propan-2-yloxycarbonylcyclohexyl) 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(4-propan-2-yloxycarbonylcyclohexyl) 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 146262477 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 4-O-(4-propan-2-yloxycarbonylcyclohexyl) 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)C1CCC(C(=O)OC2CCC(C(=O)OC(C)C)CC2)CC1 |
| InChI | InChI=1S/C27H42O8/c1-4-24(28)32-17-7-5-6-8-18-33-25(29)20-9-11-21(12-10-20)27(31)35-23-15-13-22(14-16-23)26(30)34-19(2)3/h4,19-23H,1,5-18H2,2-3H3 |
| InChIKey | VHJMYTPHKIZGOK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|