C33H52O6 — CID 118423336
[4-[(E)-(6-methyl-2-oxo-3-propan-2-ylcyclohexylidene)methyl]cyclohexyl] 4-(6-prop-2-enoyloxyhexoxy)cyclohexane-1-carboxylate (PubChem CID 118423336) has the molecular formula C33H52O6 and a molecular weight of 544.77 g/mol. Its IUPAC name is [4-[(E)-(6-methyl-2-oxo-3-propan-2-ylcyclohexylidene)methyl]cyclohexyl] 4-(6-prop-2-enoyloxyhexoxy)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-(6-methyl-2-oxo-3-propan-2-ylcyclohexylidene)methyl]cyclohexyl] 4-(6-prop-2-enoyloxyhexoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118423336 |
| Molecular Formula | C33H52O6 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | [4-[(E)-(6-methyl-2-oxo-3-propan-2-ylcyclohexylidene)methyl]cyclohexyl] 4-(6-prop-2-enoyloxyhexoxy)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOC1CCC(C(=O)OC2CCC(/C=C3/C(=O)C(C(C)C)CCC3C)CC2)CC1 |
| InChI | InChI=1S/C33H52O6/c1-5-31(34)38-21-9-7-6-8-20-37-27-17-13-26(14-18-27)33(36)39-28-15-11-25(12-16-28)22-30-24(4)10-19-29(23(2)3)32(30)35/h5,22-29H,1,6-21H2,2-4H3/b30-22+ |
| InChIKey | BJUAQQMQOKDNGG-JBASAIQMSA-N |
| XLogP | 7.15 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|