C31H36O6 — CID 91142429
[4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 91142429) has the molecular formula C31H36O6 and a molecular weight of 504.62 g/mol. Its IUPAC name is [4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 91142429 |
| Molecular Formula | C31H36O6 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C=C3C(=O)[C@H](C(C)C)CC[C@@H]3C)cc2)cc1 |
| InChI | InChI=1S/C31H36O6/c1-5-29(32)36-19-7-6-18-35-25-15-11-24(12-16-25)31(34)37-26-13-9-23(10-14-26)20-28-22(4)8-17-27(21(2)3)30(28)33/h5,9-16,20-22,27H,1,6-8,17-19H2,2-4H3/t22-,27-/m0/s1 |
| InChIKey | KILBYZQZXSDUEG-CUNXSJBXSA-N |
| XLogP | 6.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|