C35H44O7 — CID 100941742
[4-[(E)-3-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 100941742) has the molecular formula C35H44O7 and a molecular weight of 576.73 g/mol. Its IUPAC name is [4-[(E)-3-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[(E)-3-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 100941742 |
| Molecular Formula | C35H44O7 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | [4-[(E)-3-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-oxoprop-1-enyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/C=C/C(=O)OC3CC(C)CCC3C(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H44O7/c1-5-33(36)40-23-9-7-6-8-22-39-29-18-14-28(15-19-29)35(38)41-30-16-11-27(12-17-30)13-21-34(37)42-32-24-26(4)10-20-31(32)25(2)3/h5,11-19,21,25-26,31-32H,1,6-10,20,22-24H2,2-4H3/b21-13+ |
| InChIKey | BNEGPPRJTXBXHV-FYJGNVAPSA-N |
| XLogP | 7.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|