C39H44N2O7 — CID 101110065
[4-[[4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylphenyl]diazenyl]phenyl] 4-(6-prop-2-enoyloxyhexanoyl)benzoate (PubChem CID 101110065) has the molecular formula C39H44N2O7 and a molecular weight of 652.79 g/mol. Its IUPAC name is [4-[[4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylphenyl]diazenyl]phenyl] 4-(6-prop-2-enoyloxyhexanoyl)benzoate.
| Compound Name | [4-[[4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylphenyl]diazenyl]phenyl] 4-(6-prop-2-enoyloxyhexanoyl)benzoate |
|---|---|
| PubChem CID | 101110065 |
| Molecular Formula | C39H44N2O7 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | [4-[[4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylphenyl]diazenyl]phenyl] 4-(6-prop-2-enoyloxyhexanoyl)benzoate |
| SMILES | C=CC(=O)OCCCCCC(=O)c1ccc(C(=O)Oc2ccc(/N=N/c3ccc(C(=O)O[C@@H]4C[C@H](C)CC[C@H]4C(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H44N2O7/c1-5-37(43)46-24-8-6-7-9-35(42)28-11-13-29(14-12-28)38(44)47-33-21-19-32(20-22-33)41-40-31-17-15-30(16-18-31)39(45)48-36-25-27(4)10-23-34(36)26(2)3/h5,11-22,26-27,34,36H,1,6-10,23-25H2,2-4H3/b41-40+/t27-,34+,36-/m1/s1 |
| InChIKey | PQRFMYCXUMLJLF-IRHRPRKGSA-N |
| XLogP | 9.41 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|