C28H34O5 — CID 58453526
[4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-(2-methylprop-2-enoxy)benzoate (PubChem CID 58453526) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is [4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-(2-methylprop-2-enoxy)benzoate.
| Compound Name | [4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-(2-methylprop-2-enoxy)benzoate |
|---|---|
| PubChem CID | 58453526 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-(2-methylprop-2-enoxy)benzoate |
| SMILES | C=C(C)COc1ccc(C(=O)Oc2ccc(C(=O)OC3CC(C)CCC3C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H34O5/c1-18(2)17-31-23-11-7-21(8-12-23)27(29)32-24-13-9-22(10-14-24)28(30)33-26-16-20(5)6-15-25(26)19(3)4/h7-14,19-20,25-26H,1,6,15-17H2,2-5H3 |
| InChIKey | MJPNTXMSMFCULP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|