C39H46O9 — CID 58261133
4-O-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoyl]oxyphenyl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate (PubChem CID 58261133) has the molecular formula C39H46O9 and a molecular weight of 658.79 g/mol. Its IUPAC name is 4-O-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoyl]oxyphenyl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoyl]oxyphenyl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58261133 |
| Molecular Formula | C39H46O9 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | 4-O-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoyl]oxyphenyl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate |
| SMILES | CCC1(COCCOc2ccc(C(=O)Oc3ccc(OC(=O)c4ccc(C(=O)OC5CC(C)CCC5C(C)C)cc4)cc3)cc2)COC1 |
| InChI | InChI=1S/C39H46O9/c1-5-39(24-44-25-39)23-43-20-21-45-31-13-11-30(12-14-31)37(41)47-33-17-15-32(16-18-33)46-36(40)28-7-9-29(10-8-28)38(42)48-35-22-27(4)6-19-34(35)26(2)3/h7-18,26-27,34-35H,5-6,19-25H2,1-4H3 |
| InChIKey | BOKYTDZGWAYCPQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|