C38H46O7 — CID 58261232
(5-methyl-2-propan-2-ylcyclohexyl) 4-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]phenoxy]carbonylphenyl]benzoate (PubChem CID 58261232) has the molecular formula C38H46O7 and a molecular weight of 614.78 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 4-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]phenoxy]carbonylphenyl]benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]phenoxy]carbonylphenyl]benzoate |
|---|---|
| PubChem CID | 58261232 |
| Molecular Formula | C38H46O7 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]phenoxy]carbonylphenyl]benzoate |
| SMILES | CCC1(COCCOc2ccc(OC(=O)c3ccc(-c4ccc(C(=O)OC5CC(C)CCC5C(C)C)cc4)cc3)cc2)COC1 |
| InChI | InChI=1S/C38H46O7/c1-5-38(24-42-25-38)23-41-20-21-43-32-15-17-33(18-16-32)44-36(39)30-11-7-28(8-12-30)29-9-13-31(14-10-29)37(40)45-35-22-27(4)6-19-34(35)26(2)3/h7-18,26-27,34-35H,5-6,19-25H2,1-4H3 |
| InChIKey | PKCYWVPSXAEWHY-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|