C30H38O6 — CID 58261171
[4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate (PubChem CID 58261171) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is [4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate.
| Compound Name | [4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 58261171 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
| SMILES | CCC1(COc2ccc(C(=O)Oc3ccc(C(=O)OC4CC(C)CCC4C(C)C)cc3)cc2)COC1 |
| InChI | InChI=1S/C30H38O6/c1-5-30(17-33-18-30)19-34-24-11-7-22(8-12-24)28(31)35-25-13-9-23(10-14-25)29(32)36-27-16-21(4)6-15-26(27)20(2)3/h7-14,20-21,26-27H,5-6,15-19H2,1-4H3 |
| InChIKey | JYNVIJIUMMCJFM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|