C36H44O7 — CID 58261189
4-O-[6-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]naphthalen-2-yl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate (PubChem CID 58261189) has the molecular formula C36H44O7 and a molecular weight of 588.74 g/mol. Its IUPAC name is 4-O-[6-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]naphthalen-2-yl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[6-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]naphthalen-2-yl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58261189 |
| Molecular Formula | C36H44O7 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 4-O-[6-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]naphthalen-2-yl] 1-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,4-dicarboxylate |
| SMILES | CCC1(COCCOc2ccc3cc(OC(=O)c4ccc(C(=O)OC5CC(C)CCC5C(C)C)cc4)ccc3c2)COC1 |
| InChI | InChI=1S/C36H44O7/c1-5-36(22-40-23-36)21-39-16-17-41-30-13-11-29-20-31(14-12-28(29)19-30)42-34(37)26-7-9-27(10-8-26)35(38)43-33-18-25(4)6-15-32(33)24(2)3/h7-14,19-20,24-25,32-33H,5-6,15-18,21-23H2,1-4H3 |
| InChIKey | UWCNLSIJBODLEQ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|