C29H36N2O5 — CID 101257528
(5-methyl-2-propan-2-ylcyclohexyl) 4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]diazenyl]benzoate (PubChem CID 101257528) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]diazenyl]benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 101257528 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]diazenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(/N=N/c2ccc(C(=O)OC3CC(C)CCC3C(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H36N2O5/c1-19(2)26-15-6-21(5)18-27(26)36-29(33)22-7-9-23(10-8-22)30-31-24-11-13-25(14-12-24)34-16-17-35-28(32)20(3)4/h7-14,19,21,26-27H,3,6,15-18H2,1-2,4-5H3/b31-30+ |
| InChIKey | SCQXOMRBGDQIOY-NVQSTNCTSA-N |
| XLogP | 7.22 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|