C36H38O9 — CID 89189286
(2-ethyl-5-methylcyclohexyl) 4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenoxy]carbonylphenyl]benzoate (PubChem CID 89189286) has the molecular formula C36H38O9 and a molecular weight of 614.69 g/mol. Its IUPAC name is (2-ethyl-5-methylcyclohexyl) 4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenoxy]carbonylphenyl]benzoate.
| Compound Name | (2-ethyl-5-methylcyclohexyl) 4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenoxy]carbonylphenyl]benzoate |
|---|---|
| PubChem CID | 89189286 |
| Molecular Formula | C36H38O9 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | (2-ethyl-5-methylcyclohexyl) 4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenoxy]carbonylphenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)Oc1ccc(OC(=O)c2ccc(-c3ccc(C(=O)OC4CC(C)CCC4CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H38O9/c1-5-25-7-6-24(4)22-32(25)45-35(39)29-14-10-27(11-15-29)26-8-12-28(13-9-26)34(38)43-30-16-18-31(19-17-30)44-36(40)42-21-20-41-33(37)23(2)3/h8-19,24-25,32H,2,5-7,20-22H2,1,3-4H3 |
| InChIKey | WDMQAZADOPAZCE-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|