C42H38O11 — CID 90790102
[4-[[(3R,3aR,6S,6aR)-3-[3-(4-phenylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 90790102) has the molecular formula C42H38O11 and a molecular weight of 718.75 g/mol. Its IUPAC name is [4-[[(3R,3aR,6S,6aR)-3-[3-(4-phenylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-[[(3R,3aR,6S,6aR)-3-[3-(4-phenylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 90790102 |
| Molecular Formula | C42H38O11 |
| Molecular Weight | 718.75 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | [4-[[(3R,3aR,6S,6aR)-3-[3-(4-phenylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)O[C@H]3CO[C@H]4[C@@H]3OC[C@H]4OC(=O)C=Cc3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H38O11/c1-2-37(43)48-25-7-6-24-47-33-19-15-31(16-20-33)41(45)51-34-21-17-32(18-22-34)42(46)53-36-27-50-39-35(26-49-40(36)39)52-38(44)23-12-28-10-13-30(14-11-28)29-8-4-3-5-9-29/h2-5,8-23,35-36,39-40H,1,6-7,24-27H2/t35-,36+,39-,40-/m1/s1 |
| InChIKey | WNVGAMPXEHFRMJ-NURFBSRJSA-N |
| XLogP | 6.41 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.75 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|