C29H28O7 — CID 148841931
[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-ethenylbenzoate (PubChem CID 148841931) has the molecular formula C29H28O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is [4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-ethenylbenzoate.
| Compound Name | [4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 148841931 |
| Molecular Formula | C29H28O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-ethenylbenzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)OC2=CC=C(OC(=O)c3ccc(C=C)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H28O7/c1-3-21-7-9-22(10-8-21)28(31)35-25-15-17-26(18-16-25)36-29(32)23-11-13-24(14-12-23)33-19-5-6-20-34-27(30)4-2/h3-4,7-15,17H,1-2,5-6,16,18-20H2 |
| InChIKey | OVSDYNVMMFPMSL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|