C33H37NO8 — CID 137454160
[4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxymethoxy]cyclohexa-1,3-dien-1-yl] 4-(prop-2-enoylamino)benzoate (PubChem CID 137454160) has the molecular formula C33H37NO8 and a molecular weight of 575.66 g/mol. Its IUPAC name is [4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxymethoxy]cyclohexa-1,3-dien-1-yl] 4-(prop-2-enoylamino)benzoate.
| Compound Name | [4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxymethoxy]cyclohexa-1,3-dien-1-yl] 4-(prop-2-enoylamino)benzoate |
|---|---|
| PubChem CID | 137454160 |
| Molecular Formula | C33H37NO8 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | [4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxymethoxy]cyclohexa-1,3-dien-1-yl] 4-(prop-2-enoylamino)benzoate |
| SMILES | C=CC(=O)Nc1ccc(C(=O)OC2=CC=C(OCOCc3ccc(OCCCCCCOC(=O)C=C)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H37NO8/c1-3-31(35)34-27-13-11-26(12-14-27)33(37)42-30-19-17-29(18-20-30)41-24-38-23-25-9-15-28(16-10-25)39-21-7-5-6-8-22-40-32(36)4-2/h3-4,9-17,19H,1-2,5-8,18,20-24H2,(H,34,35) |
| InChIKey | LVEUVDMMHHQERU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|