C32H33NO8 — CID 158715847
ethane;[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate (PubChem CID 158715847) has the molecular formula C32H33NO8 and a molecular weight of 559.62 g/mol. Its IUPAC name is ethane;[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate.
| Compound Name | ethane;[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate |
|---|---|
| PubChem CID | 158715847 |
| Molecular Formula | C32H33NO8 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | ethane;[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate |
| SMILES | C=CC(=O)Nc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCOC(=O)C=C)cc3)cc2)cc1.CC |
| InChI | InChI=1S/C30H27NO8.C2H6/c1-3-27(32)31-23-11-7-21(8-12-23)29(34)38-25-15-17-26(18-16-25)39-30(35)22-9-13-24(14-10-22)36-19-5-6-20-37-28(33)4-2;1-2/h3-4,7-18H,1-2,5-6,19-20H2,(H,31,32);1-2H3 |
| InChIKey | IJHLGPOSAJJUDS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|