C29H25NO8 — CID 118216332
[4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate (PubChem CID 118216332) has the molecular formula C29H25NO8 and a molecular weight of 515.52 g/mol. Its IUPAC name is [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate.
| Compound Name | [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate |
|---|---|
| PubChem CID | 118216332 |
| Molecular Formula | C29H25NO8 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(prop-2-enoylamino)benzoate |
| SMILES | C=CC(=O)Nc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H25NO8/c1-3-26(31)30-22-10-6-20(7-11-22)28(33)37-24-14-16-25(17-15-24)38-29(34)21-8-12-23(13-9-21)35-18-5-19-36-27(32)4-2/h3-4,6-17H,1-2,5,18-19H2,(H,30,31) |
| InChIKey | VNJIFARIWZNRCS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|