C31H31NO8 — CID 137454200
[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-(2-methylprop-2-enoylamino)benzoate (PubChem CID 137454200) has the molecular formula C31H31NO8 and a molecular weight of 545.59 g/mol. Its IUPAC name is [4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-(2-methylprop-2-enoylamino)benzoate.
| Compound Name | [4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-(2-methylprop-2-enoylamino)benzoate |
|---|---|
| PubChem CID | 137454200 |
| Molecular Formula | C31H31NO8 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | [4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxycyclohexa-1,3-dien-1-yl] 4-(2-methylprop-2-enoylamino)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)OC2=CC=C(OC(=O)c3ccc(NC(=O)C(=C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H31NO8/c1-4-28(33)38-20-6-5-19-37-25-13-9-23(10-14-25)31(36)40-27-17-15-26(16-18-27)39-30(35)22-7-11-24(12-8-22)32-29(34)21(2)3/h4,7-15,17H,1-2,5-6,16,18-20H2,3H3,(H,32,34) |
| InChIKey | FHUMULKRWXZHNY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|