C38H62O10 — CID 140512773
[6-[[4-(4-prop-1-en-2-ylperoxybutoxy)cyclohexyl]oxymethoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-(4-prop-2-enoyloxybutoxy)cyclohexane-1-carboxylate (PubChem CID 140512773) has the molecular formula C38H62O10 and a molecular weight of 678.90 g/mol. Its IUPAC name is [6-[[4-(4-prop-1-en-2-ylperoxybutoxy)cyclohexyl]oxymethoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-(4-prop-2-enoyloxybutoxy)cyclohexane-1-carboxylate.
| Compound Name | [6-[[4-(4-prop-1-en-2-ylperoxybutoxy)cyclohexyl]oxymethoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-(4-prop-2-enoyloxybutoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 140512773 |
| Molecular Formula | C38H62O10 |
| Molecular Weight | 678.90 g/mol |
| Exact Mass | 678.43 |
| IUPAC Name | [6-[[4-(4-prop-1-en-2-ylperoxybutoxy)cyclohexyl]oxymethoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-(4-prop-2-enoyloxybutoxy)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCOC1CCC(C(=O)OC2CCC3CC(OCOC4CCC(OCCCCOOC(=C)C)CC4)CCC3C2)CC1 |
| InChI | InChI=1S/C38H62O10/c1-4-37(39)43-23-6-5-21-41-32-13-9-29(10-14-32)38(40)47-36-16-12-30-25-35(15-11-31(30)26-36)45-27-44-34-19-17-33(18-20-34)42-22-7-8-24-46-48-28(2)3/h4,29-36H,1-2,5-27H2,3H3 |
| InChIKey | IAGJSWGQHCYYSG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.90 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|