C35H57NO8 — CID 145011812
[4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxymethyl]cyclohexanecarbonyl]oxycyclohexyl]cyclohexyl] 4-(aminomethyl)cyclohexane-1-carboxylate (PubChem CID 145011812) has the molecular formula C35H57NO8 and a molecular weight of 619.84 g/mol. Its IUPAC name is [4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxymethyl]cyclohexanecarbonyl]oxycyclohexyl]cyclohexyl] 4-(aminomethyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxymethyl]cyclohexanecarbonyl]oxycyclohexyl]cyclohexyl] 4-(aminomethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 145011812 |
| Molecular Formula | C35H57NO8 |
| Molecular Weight | 619.84 g/mol |
| Exact Mass | 619.41 |
| IUPAC Name | [4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxymethyl]cyclohexanecarbonyl]oxycyclohexyl]cyclohexyl] 4-(aminomethyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCOCCOCC1CCC(C(=O)OC2CCC(C3CCC(OC(=O)C4CCC(CN)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C35H57NO8/c1-2-33(37)42-22-21-40-19-20-41-24-26-5-9-30(10-6-26)35(39)44-32-17-13-28(14-18-32)27-11-15-31(16-12-27)43-34(38)29-7-3-25(23-36)4-8-29/h2,25-32H,1,3-24,36H2 |
| InChIKey | MZRGYVHCEAVXQY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.84 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|