C42H76O7 — CID 59982562
[4-[6-[4-(4-methylcyclohexyl)cyclohexyl]oxyhexoxy]cyclohexyl] 4-(2-heptoxyethylperoxymethyl)cyclohexane-1-carboxylate (PubChem CID 59982562) has the molecular formula C42H76O7 and a molecular weight of 693.06 g/mol. Its IUPAC name is [4-[6-[4-(4-methylcyclohexyl)cyclohexyl]oxyhexoxy]cyclohexyl] 4-(2-heptoxyethylperoxymethyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[6-[4-(4-methylcyclohexyl)cyclohexyl]oxyhexoxy]cyclohexyl] 4-(2-heptoxyethylperoxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59982562 |
| Molecular Formula | C42H76O7 |
| Molecular Weight | 693.06 g/mol |
| Exact Mass | 692.56 |
| IUPAC Name | [4-[6-[4-(4-methylcyclohexyl)cyclohexyl]oxyhexoxy]cyclohexyl] 4-(2-heptoxyethylperoxymethyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCOCCOOCC1CCC(C(=O)OC2CCC(OCCCCCCOC3CCC(C4CCC(C)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C42H76O7/c1-3-4-5-6-9-28-44-31-32-47-48-33-35-14-18-38(19-15-35)42(43)49-41-26-24-40(25-27-41)46-30-11-8-7-10-29-45-39-22-20-37(21-23-39)36-16-12-34(2)13-17-36/h34-41H,3-33H2,1-2H3 |
| InChIKey | SOIBVZXVIFCCRE-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.06 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|