C37H58O6 — CID 88591300
[4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] 4-(but-3-enylperoxymethyl)cyclohexane-1-carboxylate (PubChem CID 88591300) has the molecular formula C37H58O6 and a molecular weight of 598.87 g/mol. Its IUPAC name is [4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] 4-(but-3-enylperoxymethyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] 4-(but-3-enylperoxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88591300 |
| Molecular Formula | C37H58O6 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.42 |
| IUPAC Name | [4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] 4-(but-3-enylperoxymethyl)cyclohexane-1-carboxylate |
| SMILES | C=CCCOOCC1CCC(C(=O)OC2CCC(C3CCC(OCCCCCCOc4ccc(C)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C37H58O6/c1-3-4-27-41-42-28-30-11-13-33(14-12-30)37(38)43-36-23-17-32(18-24-36)31-15-21-35(22-16-31)40-26-8-6-5-7-25-39-34-19-9-29(2)10-20-34/h3,9-10,19-20,30-33,35-36H,1,4-8,11-18,21-28H2,2H3 |
| InChIKey | ZMZFBTPQLJOBNW-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|