C43H58O6 — CID 59498925
[4-[3-[4-[6-[4-(4-butoxyphenyl)phenoxy]hexoxy]cyclohexyl]propoxy]phenyl] hex-5-enoate (PubChem CID 59498925) has the molecular formula C43H58O6 and a molecular weight of 670.93 g/mol. Its IUPAC name is [4-[3-[4-[6-[4-(4-butoxyphenyl)phenoxy]hexoxy]cyclohexyl]propoxy]phenyl] hex-5-enoate.
| Compound Name | [4-[3-[4-[6-[4-(4-butoxyphenyl)phenoxy]hexoxy]cyclohexyl]propoxy]phenyl] hex-5-enoate |
|---|---|
| PubChem CID | 59498925 |
| Molecular Formula | C43H58O6 |
| Molecular Weight | 670.93 g/mol |
| Exact Mass | 670.42 |
| IUPAC Name | [4-[3-[4-[6-[4-(4-butoxyphenyl)phenoxy]hexoxy]cyclohexyl]propoxy]phenyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)Oc1ccc(OCCCC2CCC(OCCCCCCOc3ccc(-c4ccc(OCCCC)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C43H58O6/c1-3-5-9-14-43(44)49-42-29-27-41(28-30-42)48-34-12-13-35-15-21-38(22-16-35)46-32-10-7-8-11-33-47-40-25-19-37(20-26-40)36-17-23-39(24-18-36)45-31-6-4-2/h3,17-20,23-30,35,38H,1,4-16,21-22,31-34H2,2H3 |
| InChIKey | JGKKQZKTFQNFAV-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.93 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|