C37H56O6 — CID 59498900
4-O-but-1-en-2-yl 1-O-[4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate (PubChem CID 59498900) has the molecular formula C37H56O6 and a molecular weight of 596.85 g/mol. Its IUPAC name is 4-O-but-1-en-2-yl 1-O-[4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-but-1-en-2-yl 1-O-[4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59498900 |
| Molecular Formula | C37H56O6 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.41 |
| IUPAC Name | 4-O-but-1-en-2-yl 1-O-[4-[4-[6-(4-methylphenoxy)hexoxy]cyclohexyl]cyclohexyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=C(CC)OC(=O)C1CCC(C(=O)OC2CCC(C3CCC(OCCCCCCOc4ccc(C)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C37H56O6/c1-4-28(3)42-36(38)31-11-13-32(14-12-31)37(39)43-35-23-17-30(18-24-35)29-15-21-34(22-16-29)41-26-8-6-5-7-25-40-33-19-9-27(2)10-20-33/h9-10,19-20,29-32,34-35H,3-8,11-18,21-26H2,1-2H3 |
| InChIKey | IWZAUCXDAFRCON-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|