C22H34O4 — CID 19986715
ethyl 4-(4-heptoxyphenyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 19986715) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is ethyl 4-(4-heptoxyphenyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(4-heptoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19986715 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | ethyl 4-(4-heptoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCCCCCCOc1ccc(C2(O)CCC(C(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C22H34O4/c1-3-5-6-7-8-17-26-20-11-9-19(10-12-20)22(24)15-13-18(14-16-22)21(23)25-4-2/h9-12,18,24H,3-8,13-17H2,1-2H3 |
| InChIKey | ZRWNKCGGKJSYDN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|