C25H40O4 — CID 19986764
octyl 4-(4-butoxyphenyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 19986764) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is octyl 4-(4-butoxyphenyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | octyl 4-(4-butoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19986764 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | octyl 4-(4-butoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CCC(O)(c2ccc(OCCCC)cc2)CC1 |
| InChI | InChI=1S/C25H40O4/c1-3-5-7-8-9-10-20-29-24(26)21-15-17-25(27,18-16-21)22-11-13-23(14-12-22)28-19-6-4-2/h11-14,21,27H,3-10,15-20H2,1-2H3 |
| InChIKey | LBZONOPHJZZWGC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|