C29H40O4 — CID 19986843
hexyl 4-[4-(4-butoxyphenyl)phenyl]-4-hydroxycyclohexane-1-carboxylate (PubChem CID 19986843) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is hexyl 4-[4-(4-butoxyphenyl)phenyl]-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | hexyl 4-[4-(4-butoxyphenyl)phenyl]-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19986843 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | hexyl 4-[4-(4-butoxyphenyl)phenyl]-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCCCCCOC(=O)C1CCC(O)(c2ccc(-c3ccc(OCCCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H40O4/c1-3-5-7-8-22-33-28(30)25-17-19-29(31,20-18-25)26-13-9-23(10-14-26)24-11-15-27(16-12-24)32-21-6-4-2/h9-16,25,31H,3-8,17-22H2,1-2H3 |
| InChIKey | QKKUIQLDNXJUSQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|