C27H36O5 — CID 70403902
[4-[4-(4-ethoxyphenyl)phenyl]-4-hydroxycyclohexyl] hexyl carbonate (PubChem CID 70403902) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is [4-[4-(4-ethoxyphenyl)phenyl]-4-hydroxycyclohexyl] hexyl carbonate.
| Compound Name | [4-[4-(4-ethoxyphenyl)phenyl]-4-hydroxycyclohexyl] hexyl carbonate |
|---|---|
| PubChem CID | 70403902 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [4-[4-(4-ethoxyphenyl)phenyl]-4-hydroxycyclohexyl] hexyl carbonate |
| SMILES | CCCCCCOC(=O)OC1CCC(O)(c2ccc(-c3ccc(OCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H36O5/c1-3-5-6-7-20-31-26(28)32-25-16-18-27(29,19-17-25)23-12-8-21(9-13-23)22-10-14-24(15-11-22)30-4-2/h8-15,25,29H,3-7,16-20H2,1-2H3 |
| InChIKey | JZJXRGYFXLTDMW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|