C21H32O4 — CID 19986643
hexyl 4-(4-ethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 19986643) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is hexyl 4-(4-ethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | hexyl 4-(4-ethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19986643 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | hexyl 4-(4-ethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCCCCCOC(=O)C1CCC(O)(c2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C21H32O4/c1-3-5-6-7-16-25-20(22)17-12-14-21(23,15-13-17)18-8-10-19(11-9-18)24-4-2/h8-11,17,23H,3-7,12-16H2,1-2H3 |
| InChIKey | NPCILGPIGQXNKP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|