C27H44O4 — CID 19986827
hexyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 19986827) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is hexyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | hexyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19986827 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | hexyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCOc1ccc(C2(O)CCC(C(=O)OCCCCCC)CC2)cc1 |
| InChI | InChI=1S/C27H44O4/c1-3-5-7-9-10-12-21-30-25-15-13-24(14-16-25)27(29)19-17-23(18-20-27)26(28)31-22-11-8-6-4-2/h13-16,23,29H,3-12,17-22H2,1-2H3 |
| InChIKey | IGKVSPUZRZSDMP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|