C29H48O4 — CID 19986786
octyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 19986786) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is octyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | octyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19986786 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | octyl 4-hydroxy-4-(4-octoxyphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CCC(O)(c2ccc(OCCCCCCCC)cc2)CC1 |
| InChI | InChI=1S/C29H48O4/c1-3-5-7-9-11-13-23-32-27-17-15-26(16-18-27)29(31)21-19-25(20-22-29)28(30)33-24-14-12-10-8-6-4-2/h15-18,25,31H,3-14,19-24H2,1-2H3 |
| InChIKey | MTYIQPOHVYUZQG-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|