C34H54O3 — CID 59265441
1-[7-[4-[4-(4-ethylcyclohexyl)cyclohexyl]cyclohexyl]oxyhept-1-en-2-ylperoxy]-4-methylbenzene (PubChem CID 59265441) has the molecular formula C34H54O3 and a molecular weight of 510.80 g/mol. Its IUPAC name is 1-[7-[4-[4-(4-ethylcyclohexyl)cyclohexyl]cyclohexyl]oxyhept-1-en-2-ylperoxy]-4-methylbenzene.
| Compound Name | 1-[7-[4-[4-(4-ethylcyclohexyl)cyclohexyl]cyclohexyl]oxyhept-1-en-2-ylperoxy]-4-methylbenzene |
|---|---|
| PubChem CID | 59265441 |
| Molecular Formula | C34H54O3 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | 1-[7-[4-[4-(4-ethylcyclohexyl)cyclohexyl]cyclohexyl]oxyhept-1-en-2-ylperoxy]-4-methylbenzene |
| SMILES | C=C(CCCCCOC1CCC(C2CCC(C3CCC(CC)CC3)CC2)CC1)OOc1ccc(C)cc1 |
| InChI | InChI=1S/C34H54O3/c1-4-28-11-13-29(14-12-28)30-15-17-31(18-16-30)32-19-23-33(24-20-32)35-25-7-5-6-8-27(3)36-37-34-21-9-26(2)10-22-34/h9-10,21-22,28-33H,3-8,11-20,23-25H2,1-2H3 |
| InChIKey | NGFDRCOPXZNMOZ-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|