C20H36O — CID 57032891
1-but-2-enyl-4-(4-butoxycyclohexyl)cyclohexane (PubChem CID 57032891) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-but-2-enyl-4-(4-butoxycyclohexyl)cyclohexane.
| Compound Name | 1-but-2-enyl-4-(4-butoxycyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 57032891 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 1-but-2-enyl-4-(4-butoxycyclohexyl)cyclohexane |
| SMILES | CC=CCC1CCC(C2CCC(OCCCC)CC2)CC1 |
| InChI | InChI=1S/C20H36O/c1-3-5-7-17-8-10-18(11-9-17)19-12-14-20(15-13-19)21-16-6-4-2/h3,5,17-20H,4,6-16H2,1-2H3 |
| InChIKey | SKJLSDLNXFMWKM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|